C17H13Cl3FN3O — CID 160793216
4,5,7-trichloro-6-fluoro-1-(2-methyl-6-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 160793216) has the molecular formula C17H13Cl3FN3O and a molecular weight of 400.67 g/mol. Its IUPAC name is 4,5,7-trichloro-6-fluoro-1-(2-methyl-6-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4,5,7-trichloro-6-fluoro-1-(2-methyl-6-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 160793216 |
| Molecular Formula | C17H13Cl3FN3O |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 4,5,7-trichloro-6-fluoro-1-(2-methyl-6-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | Cc1cccc(C(C)C)c1-n1c(=O)nc(Cl)c2c(Cl)c(F)c(Cl)nc21 |
| InChI | InChI=1S/C17H13Cl3FN3O/c1-7(2)9-6-4-5-8(3)13(9)24-16-10(14(19)23-17(24)25)11(18)12(21)15(20)22-16/h4-7H,1-3H3 |
| InChIKey | SCCDJVDRTLFJOD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|