C28H33B2F4NO7 — CID 160793783
(4-fluorophenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid (PubChem CID 160793783) has the molecular formula C28H33B2F4NO7 and a molecular weight of 593.19 g/mol. Its IUPAC name is (4-fluorophenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid.
| Compound Name | (4-fluorophenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid |
|---|---|
| PubChem CID | 160793783 |
| Molecular Formula | C28H33B2F4NO7 |
| Molecular Weight | 593.19 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | (4-fluorophenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C(F)(F)F)n1.O=C(O)COCc1ccccc1.OB(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17BF3NO2.C9H10O3.C6H6BFO2/c1-8-6-9(7-10(18-8)13(15,16)17)14-19-11(2,3)12(4,5)20-14;10-9(11)7-12-6-8-4-2-1-3-5-8;8-6-3-1-5(2-4-6)7(9)10/h6-7H,1-5H3;1-5H,6-7H2,(H,10,11);1-4,9-10H |
| InChIKey | SCDZKLZWHBCJOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|