About 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol
5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol (PubChem CID 160794330) has the molecular formula C7H8N2O5
and a molecular weight of 200.15 g/mol. Its IUPAC name is 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol |
| PubChem CID | 160794330 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol |
| SMILES | CC1=CC=CC(O)C1([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N2O5/c1-5-3-2-4-6(10)7(5,8(11)12)9(13)14/h2-4,6,10H,1H3 |
| InChIKey | KONUQBIQLJEGNY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol?
The IUPAC name of 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol (CID 160794330) is 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol?
The canonical SMILES for 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol is CC1=CC=CC(O)C1([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol?
The InChIKey is KONUQBIQLJEGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O5/c1-5-3-2-4-6(10)7(5,8(11)12)9(13)14/h2-4,6,10H,1H3.
What are the key properties of 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol?
5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol has a molecular weight of 200.15 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6,6-dinitrocyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 160794330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).