C26H19F6P — CID 160794624
[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-triphenylphosphanium fluoride (PubChem CID 160794624) has the molecular formula C26H19F6P and a molecular weight of 476.40 g/mol. Its IUPAC name is [2-(1,1,2,2,2-pentafluoroethyl)phenyl]-triphenylphosphanium fluoride.
| Compound Name | [2-(1,1,2,2,2-pentafluoroethyl)phenyl]-triphenylphosphanium fluoride |
|---|---|
| PubChem CID | 160794624 |
| Molecular Formula | C26H19F6P |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | [2-(1,1,2,2,2-pentafluoroethyl)phenyl]-triphenylphosphanium fluoride |
| SMILES | FC(F)(F)C(F)(F)c1ccccc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[F-] |
| InChI | InChI=1S/C26H19F5P.FH/c27-25(28,26(29,30)31)23-18-10-11-19-24(23)32(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-19H;1H/q+1;/p-1 |
| InChIKey | SCGVBNYIZGLFME-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|