C17H33F3O2 — CID 160797160
1-butan-2-yloxy-3-methylbut-3-en-2-one;propane;1,1,1-trifluoro-2-methylbutane (PubChem CID 160797160) has the molecular formula C17H33F3O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-butan-2-yloxy-3-methylbut-3-en-2-one;propane;1,1,1-trifluoro-2-methylbutane.
| Compound Name | 1-butan-2-yloxy-3-methylbut-3-en-2-one;propane;1,1,1-trifluoro-2-methylbutane |
|---|---|
| PubChem CID | 160797160 |
| Molecular Formula | C17H33F3O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-butan-2-yloxy-3-methylbut-3-en-2-one;propane;1,1,1-trifluoro-2-methylbutane |
| SMILES | C=C(C)C(=O)COC(C)CC.CCC.CCC(C)C(F)(F)F |
| InChI | InChI=1S/C9H16O2.C5H9F3.C3H8/c1-5-8(4)11-6-9(10)7(2)3;1-3-4(2)5(6,7)8;1-3-2/h8H,2,5-6H2,1,3-4H3;4H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | SCOZLYVPXDHREE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|