About 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate
4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate (PubChem CID 160797974) has the molecular formula C18H31NO5
and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate |
| PubChem CID | 160797974 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate |
| SMILES | CCC(C)/C=C\COCCOC(=O)/C=C/C(=O)OCC(C)(N)CC |
| InChI | InChI=1S/C18H31NO5/c1-5-15(3)8-7-11-22-12-13-23-16(20)9-10-17(21)24-14-18(4,19)6-2/h7-10,15H,5-6,11-14,19H2,1-4H3/b8-7-,10-9+ |
| InChIKey | SCRNRKQWKCAQRD-UQGDGPGGSA-N |
| XLogP | 2.38 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate?
The IUPAC name of 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate (CID 160797974) is 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate.
What is the SMILES notation for 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate?
The canonical SMILES for 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate is CCC(C)/C=C\COCCOC(=O)/C=C/C(=O)OCC(C)(N)CC.
What is the InChIKey of 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate?
The InChIKey is SCRNRKQWKCAQRD-UQGDGPGGSA-N. The full InChI is InChI=1S/C18H31NO5/c1-5-15(3)8-7-11-22-12-13-23-16(20)9-10-17(21)24-14-18(4,19)6-2/h7-10,15H,5-6,11-14,19H2,1-4H3/b8-7-,10-9+.
What are the key properties of 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate?
4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate has a molecular weight of 341.45 g/mol, XLogP of 2.38, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-amino-2-methylbutyl) 1-O-[2-[(Z)-4-methylhex-2-enoxy]ethyl] (E)-but-2-enedioate is sourced from PubChem (CID 160797974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).