C42H81N3O3 — CID 160798735
N-tert-butyl-2-(2,2-dimethylpropyl)hex-5-enamide;N-tert-butyl-2-propan-2-ylhex-5-enamide;N,2-ditert-butylhex-5-enamide (PubChem CID 160798735) has the molecular formula C42H81N3O3 and a molecular weight of 676.13 g/mol. Its IUPAC name is N-tert-butyl-2-(2,2-dimethylpropyl)hex-5-enamide;N-tert-butyl-2-propan-2-ylhex-5-enamide;N,2-ditert-butylhex-5-enamide.
| Compound Name | N-tert-butyl-2-(2,2-dimethylpropyl)hex-5-enamide;N-tert-butyl-2-propan-2-ylhex-5-enamide;N,2-ditert-butylhex-5-enamide |
|---|---|
| PubChem CID | 160798735 |
| Molecular Formula | C42H81N3O3 |
| Molecular Weight | 676.13 g/mol |
| Exact Mass | 675.63 |
| IUPAC Name | N-tert-butyl-2-(2,2-dimethylpropyl)hex-5-enamide;N-tert-butyl-2-propan-2-ylhex-5-enamide;N,2-ditert-butylhex-5-enamide |
| SMILES | C=CCCC(C(=O)NC(C)(C)C)C(C)(C)C.C=CCCC(C(=O)NC(C)(C)C)C(C)C.C=CCCC(CC(C)(C)C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H29NO.C14H27NO.C13H25NO/c1-8-9-10-12(11-14(2,3)4)13(17)16-15(5,6)7;1-8-9-10-11(13(2,3)4)12(16)15-14(5,6)7;1-7-8-9-11(10(2)3)12(15)14-13(4,5)6/h8,12H,1,9-11H2,2-7H3,(H,16,17);8,11H,1,9-10H2,2-7H3,(H,15,16);7,10-11H,1,8-9H2,2-6H3,(H,14,15) |
| InChIKey | SCTZVSLRMZYCAT-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.13 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|