C44H72O4 — CID 160798778
2-(4-methylcyclohex-3-en-1-yl)propan-2-yl acetate;2-[2,6,6-trimethyl-1-[2,6,6-trimethyl-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]-2-bicyclo[3.1.1]heptanyl]acetic acid (PubChem CID 160798778) has the molecular formula C44H72O4 and a molecular weight of 665.06 g/mol. Its IUPAC name is 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl acetate;2-[2,6,6-trimethyl-1-[2,6,6-trimethyl-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]-2-bicyclo[3.1.1]heptanyl]acetic acid.
| Compound Name | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl acetate;2-[2,6,6-trimethyl-1-[2,6,6-trimethyl-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]-2-bicyclo[3.1.1]heptanyl]acetic acid |
|---|---|
| PubChem CID | 160798778 |
| Molecular Formula | C44H72O4 |
| Molecular Weight | 665.06 g/mol |
| Exact Mass | 664.54 |
| IUPAC Name | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl acetate;2-[2,6,6-trimethyl-1-[2,6,6-trimethyl-2-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]-2-bicyclo[3.1.1]heptanyl]acetic acid |
| SMILES | CC(=O)OC(C)(C)C1CC=C(C)CC1.CC1CCC2CC1(C1(C)CCC3CC1(C14CC(CCC1(C)CC(=O)O)C4(C)C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C32H52O2.C12H20O2/c1-20-10-11-21-16-30(20,25(21,2)3)29(9)15-13-23-18-32(29,27(23,6)7)31-17-22(26(31,4)5)12-14-28(31,8)19-24(33)34;1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h20-23H,10-19H2,1-9H3,(H,33,34);5,11H,6-8H2,1-4H3 |
| InChIKey | SCUCIBVVKNPGEZ-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.06 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|