About 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium)
1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) (PubChem CID 160800513) has the molecular formula C10H20Cl4O6P2+2
and a molecular weight of 440.02 g/mol. Its IUPAC name is 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium).
Molecular Properties
| Compound Name | 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) |
| PubChem CID | 160800513 |
| Molecular Formula | C10H20Cl4O6P2+2 |
| Molecular Weight | 440.02 g/mol |
| Exact Mass | 437.95 |
| IUPAC Name | 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) |
| SMILES | ClCCC(CCCl)=C(CCCl)CCCl.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C10H16Cl4.2HO3P/c11-5-1-9(2-6-12)10(3-7-13)4-8-14;2*1-4(2)3/h1-8H2;2*(H-,1,2,3)/p+2 |
| InChIKey | GNZTUXIPOVUGKO-UHFFFAOYSA-P |
| XLogP | 4.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.02 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium)?
The IUPAC name of 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) (CID 160800513) is 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium).
What is the SMILES notation for 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium)?
The canonical SMILES for 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) is ClCCC(CCCl)=C(CCCl)CCCl.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium)?
The InChIKey is GNZTUXIPOVUGKO-UHFFFAOYSA-P. The full InChI is InChI=1S/C10H16Cl4.2HO3P/c11-5-1-9(2-6-12)10(3-7-13)4-8-14;2*1-4(2)3/h1-8H2;2*(H-,1,2,3)/p+2.
What are the key properties of 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium)?
1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) has a molecular weight of 440.02 g/mol, XLogP of 4.06, 8 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dichloro-3,4-bis(2-chloroethyl)hex-3-ene;bis(dihydroxy(oxo)phosphanium) is sourced from PubChem (CID 160800513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).