About 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane
1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane (PubChem CID 160801299) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane.
Molecular Properties
| Compound Name | 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane |
| PubChem CID | 160801299 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane |
| SMILES | CC.CC(C)(C)N1C(=O)C=CC1(C)C |
| InChI | InChI=1S/C10H17NO.C2H6/c1-9(2,3)11-8(12)6-7-10(11,4)5;1-2/h6-7H,1-5H3;1-2H3 |
| InChIKey | SDCJMUJZXSNKLN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane?
The IUPAC name of 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane (CID 160801299) is 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane.
What is the SMILES notation for 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane?
The canonical SMILES for 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane is CC.CC(C)(C)N1C(=O)C=CC1(C)C.
What is the InChIKey of 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane?
The InChIKey is SDCJMUJZXSNKLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.C2H6/c1-9(2,3)11-8(12)6-7-10(11,4)5;1-2/h6-7H,1-5H3;1-2H3.
What are the key properties of 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane?
1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane has a molecular weight of 197.32 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5,5-dimethylpyrrol-2-one;ethane is sourced from PubChem (CID 160801299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).