About pyrene;quinoxaline
pyrene;quinoxaline (PubChem CID 160801316) has the molecular formula C32H22N4
and a molecular weight of 462.56 g/mol. Its IUPAC name is pyrene;quinoxaline.
Molecular Properties
| Compound Name | pyrene;quinoxaline |
| PubChem CID | 160801316 |
| Molecular Formula | C32H22N4 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | pyrene;quinoxaline |
| SMILES | c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc2nccnc2c1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C16H10.2C8H6N2/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;2*1-2-4-8-7(3-1)9-5-6-10-8/h1-10H;2*1-6H |
| InChIKey | SDCKQMATJBKKFK-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene;quinoxaline?
The IUPAC name of pyrene;quinoxaline (CID 160801316) is pyrene;quinoxaline.
What is the SMILES notation for pyrene;quinoxaline?
The canonical SMILES for pyrene;quinoxaline is c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc2nccnc2c1.c1ccc2nccnc2c1.
What is the InChIKey of pyrene;quinoxaline?
The InChIKey is SDCKQMATJBKKFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.2C8H6N2/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;2*1-2-4-8-7(3-1)9-5-6-10-8/h1-10H;2*1-6H.
What are the key properties of pyrene;quinoxaline?
pyrene;quinoxaline has a molecular weight of 462.56 g/mol, XLogP of 7.84, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene;quinoxaline is sourced from PubChem (CID 160801316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).