C11H22O7P2 — CID 160801407
[(E)-3-[(2R,3S,4S,5S)-3-[methoxy(methyl)phosphoryl]oxy-4,5-dimethyloxolan-2-yl]prop-2-enyl]phosphonic acid (PubChem CID 160801407) has the molecular formula C11H22O7P2 and a molecular weight of 328.24 g/mol. Its IUPAC name is [(E)-3-[(2R,3S,4S,5S)-3-[methoxy(methyl)phosphoryl]oxy-4,5-dimethyloxolan-2-yl]prop-2-enyl]phosphonic acid.
| Compound Name | [(E)-3-[(2R,3S,4S,5S)-3-[methoxy(methyl)phosphoryl]oxy-4,5-dimethyloxolan-2-yl]prop-2-enyl]phosphonic acid |
|---|---|
| PubChem CID | 160801407 |
| Molecular Formula | C11H22O7P2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | [(E)-3-[(2R,3S,4S,5S)-3-[methoxy(methyl)phosphoryl]oxy-4,5-dimethyloxolan-2-yl]prop-2-enyl]phosphonic acid |
| SMILES | COP(C)(=O)O[C@H]1[C@@H](C)[C@H](C)O[C@@H]1/C=C/CP(=O)(O)O |
| InChI | InChI=1S/C11H22O7P2/c1-8-9(2)17-10(6-5-7-20(13,14)15)11(8)18-19(4,12)16-3/h5-6,8-11H,7H2,1-4H3,(H2,13,14,15)/b6-5+/t8-,9-,10+,11-,19?/m0/s1 |
| InChIKey | SDCRIIJVIHBTMK-IVUVCCAUSA-N |
| XLogP | 2.00 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|