C40H48N4O2+2 — CID 160801589
4,6,23-tritert-butyl-21-(4-imidazol-1-ylbutyl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene (PubChem CID 160801589) has the molecular formula C40H48N4O2+2 and a molecular weight of 616.85 g/mol. Its IUPAC name is 4,6,23-tritert-butyl-21-(4-imidazol-1-ylbutyl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene.
| Compound Name | 4,6,23-tritert-butyl-21-(4-imidazol-1-ylbutyl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
|---|---|
| PubChem CID | 160801589 |
| Molecular Formula | C40H48N4O2+2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | 4,6,23-tritert-butyl-21-(4-imidazol-1-ylbutyl)-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,11,13,15,17,19(24),20,22-undecaene |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OC13Oc4c(cc(CCCCn5ccnc5)cc4C(C)(C)C)C=[N+]1c1ccccc1[N+]3=C2 |
| InChI | InChI=1S/C40H48N4O2/c1-37(2,3)30-22-29-25-44-34-16-11-10-15-33(34)43-24-28-20-27(14-12-13-18-42-19-17-41-26-42)21-31(38(4,5)6)35(28)45-40(43,44)46-36(29)32(23-30)39(7,8)9/h10-11,15-17,19-26H,12-14,18H2,1-9H3/q+2 |
| InChIKey | FZBQMQITKFLSFE-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 42.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|