About pyrene-1-diazonium chloride
pyrene-1-diazonium chloride (PubChem CID 160801716) has the molecular formula C16H9ClN2
and a molecular weight of 264.72 g/mol. Its IUPAC name is pyrene-1-diazonium chloride.
Molecular Properties
| Compound Name | pyrene-1-diazonium chloride |
| PubChem CID | 160801716 |
| Molecular Formula | C16H9ClN2 |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | pyrene-1-diazonium chloride |
| SMILES | N#[N+]c1ccc2ccc3cccc4ccc1c2c34.[Cl-] |
| InChI | InChI=1S/C16H9N2.ClH/c17-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;/h1-9H;1H/q+1;/p-1 |
| InChIKey | SDDUWWFGMFYHBL-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene-1-diazonium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene-1-diazonium chloride?
The IUPAC name of pyrene-1-diazonium chloride (CID 160801716) is pyrene-1-diazonium chloride.
What is the SMILES notation for pyrene-1-diazonium chloride?
The canonical SMILES for pyrene-1-diazonium chloride is N#[N+]c1ccc2ccc3cccc4ccc1c2c34.[Cl-].
What is the InChIKey of pyrene-1-diazonium chloride?
The InChIKey is SDDUWWFGMFYHBL-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H9N2.ClH/c17-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;/h1-9H;1H/q+1;/p-1.
What are the key properties of pyrene-1-diazonium chloride?
pyrene-1-diazonium chloride has a molecular weight of 264.72 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene-1-diazonium chloride is sourced from PubChem (CID 160801716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).