About sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol
sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol (PubChem CID 160802037) has the molecular formula C7H19NOS2
and a molecular weight of 200.39 g/mol. Its IUPAC name is sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol.
Molecular Properties
| Compound Name | sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol |
| PubChem CID | 160802037 |
| Molecular Formula | C7H19NOS2 |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol |
| SMILES | S.S.[2H]C([2H])([2H])[C@](C)(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C7H15NO.2H2S/c1-7(2,9)6-4-3-5-8-6;;/h6,8-9H,3-5H2,1-2H3;2*1H2/t6-;;/m0../s1/i1D3;;/t6-,7+;; |
| InChIKey | SDEVRJGJWMJQEQ-WZOABKLTSA-N |
| XLogP | 0.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol?
The IUPAC name of sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol (CID 160802037) is sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol.
What is the SMILES notation for sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol?
The canonical SMILES for sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol is S.S.[2H]C([2H])([2H])[C@](C)(O)[C@@H]1CCCN1.
What is the InChIKey of sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol?
The InChIKey is SDEVRJGJWMJQEQ-WZOABKLTSA-N. The full InChI is InChI=1S/C7H15NO.2H2S/c1-7(2,9)6-4-3-5-8-6;;/h6,8-9H,3-5H2,1-2H3;2*1H2/t6-;;/m0../s1/i1D3;;/t6-,7+;;.
What are the key properties of sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol?
sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol has a molecular weight of 200.39 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;(2S)-1,1,1-trideuterio-2-[(2S)-pyrrolidin-2-yl]propan-2-ol is sourced from PubChem (CID 160802037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).