About 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide
4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide (PubChem CID 160802548) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide.
Molecular Properties
| Compound Name | 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide |
| PubChem CID | 160802548 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide |
| SMILES | CCc1c(C(C)=O)c(S(N)(=O)=O)c(CC)n1C |
| InChI | InChI=1S/C11H18N2O3S/c1-5-8-10(7(3)14)11(17(12,15)16)9(6-2)13(8)4/h5-6H2,1-4H3,(H2,12,15,16) |
| InChIKey | KUUGPMKLCZDXKJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide?
The IUPAC name of 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide (CID 160802548) is 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide.
What is the SMILES notation for 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide?
The canonical SMILES for 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide is CCc1c(C(C)=O)c(S(N)(=O)=O)c(CC)n1C.
What is the InChIKey of 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide?
The InChIKey is KUUGPMKLCZDXKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S/c1-5-8-10(7(3)14)11(17(12,15)16)9(6-2)13(8)4/h5-6H2,1-4H3,(H2,12,15,16).
What are the key properties of 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide?
4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide has a molecular weight of 258.34 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-2,5-diethyl-1-methylpyrrole-3-sulfonamide is sourced from PubChem (CID 160802548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).