C38H28ClFN4O3 — CID 160803631
1-[4-[8-chloro-6-fluoro-4,7-bis(3-hydroxynaphthalen-1-yl)imidazo[4,5-c]quinolin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 160803631) has the molecular formula C38H28ClFN4O3 and a molecular weight of 643.12 g/mol. Its IUPAC name is 1-[4-[8-chloro-6-fluoro-4,7-bis(3-hydroxynaphthalen-1-yl)imidazo[4,5-c]quinolin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[8-chloro-6-fluoro-4,7-bis(3-hydroxynaphthalen-1-yl)imidazo[4,5-c]quinolin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 160803631 |
| Molecular Formula | C38H28ClFN4O3 |
| Molecular Weight | 643.12 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | 1-[4-[8-chloro-6-fluoro-4,7-bis(3-hydroxynaphthalen-1-yl)imidazo[4,5-c]quinolin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2cnc3c(-c4cc(O)cc5ccccc45)nc4c(F)c(-c5cc(O)cc6ccccc56)c(Cl)cc4c32)CC1 |
| InChI | InChI=1S/C38H28ClFN4O3/c1-2-32(47)43-13-11-23(12-14-43)44-20-41-37-36(29-18-25(46)16-22-8-4-6-10-27(22)29)42-35-30(38(37)44)19-31(39)33(34(35)40)28-17-24(45)15-21-7-3-5-9-26(21)28/h2-10,15-20,23,45-46H,1,11-14H2 |
| InChIKey | SDKCHRYQYVYKIM-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.12 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|