C15H12F6N2O — CID 160804055
2,2,2-trifluoroacetaldehyde;[2-[4-(trifluoromethyl)phenyl]-4-pyridinyl]methanamine (PubChem CID 160804055) has the molecular formula C15H12F6N2O and a molecular weight of 350.26 g/mol. Its IUPAC name is 2,2,2-trifluoroacetaldehyde;[2-[4-(trifluoromethyl)phenyl]-4-pyridinyl]methanamine.
| Compound Name | 2,2,2-trifluoroacetaldehyde;[2-[4-(trifluoromethyl)phenyl]-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 160804055 |
| Molecular Formula | C15H12F6N2O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2,2,2-trifluoroacetaldehyde;[2-[4-(trifluoromethyl)phenyl]-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(-c2ccc(C(F)(F)F)cc2)c1.O=CC(F)(F)F |
| InChI | InChI=1S/C13H11F3N2.C2HF3O/c14-13(15,16)11-3-1-10(2-4-11)12-7-9(8-17)5-6-18-12;3-2(4,5)1-6/h1-7H,8,17H2;1H |
| InChIKey | SDLMQDNZZHBRDH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|