About N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide
N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide (PubChem CID 160804127) has the molecular formula C15H27N3O3
and a molecular weight of 297.40 g/mol. Its IUPAC name is N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide.
Molecular Properties
| Compound Name | N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide |
| PubChem CID | 160804127 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide |
| SMILES | C=C(C)N(C)C(=O)CC.C=CN(C)C(C)=O.C=CNC=O |
| InChI | InChI=1S/C7H13NO.C5H9NO.C3H5NO/c1-5-7(9)8(4)6(2)3;1-4-6(3)5(2)7;1-2-4-3-5/h2,5H2,1,3-4H3;4H,1H2,2-3H3;2-3H,1H2,(H,4,5) |
| InChIKey | SDLSNBUTYUFAKU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide?
The IUPAC name of N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide (CID 160804127) is N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide.
What is the SMILES notation for N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide?
The canonical SMILES for N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide is C=C(C)N(C)C(=O)CC.C=CN(C)C(C)=O.C=CNC=O.
What is the InChIKey of N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide?
The InChIKey is SDLSNBUTYUFAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C5H9NO.C3H5NO/c1-5-7(9)8(4)6(2)3;1-4-6(3)5(2)7;1-2-4-3-5/h2,5H2,1,3-4H3;4H,1H2,2-3H3;2-3H,1H2,(H,4,5).
What are the key properties of N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide?
N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide has a molecular weight of 297.40 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylformamide;N-ethenyl-N-methylacetamide;N-methyl-N-prop-1-en-2-ylpropanamide is sourced from PubChem (CID 160804127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).