C31H32Cl3N3O3 — CID 160806245
4-[2-chloro-6-[2-chloro-3-[2-chloro-3-[5-[(2-hydroxyethylamino)methyl]-6-methoxy-2-pyridinyl]phenyl]phenyl]-4-methyl-3-pyridinyl]butan-1-ol (PubChem CID 160806245) has the molecular formula C31H32Cl3N3O3 and a molecular weight of 600.97 g/mol. Its IUPAC name is 4-[2-chloro-6-[2-chloro-3-[2-chloro-3-[5-[(2-hydroxyethylamino)methyl]-6-methoxy-2-pyridinyl]phenyl]phenyl]-4-methyl-3-pyridinyl]butan-1-ol.
| Compound Name | 4-[2-chloro-6-[2-chloro-3-[2-chloro-3-[5-[(2-hydroxyethylamino)methyl]-6-methoxy-2-pyridinyl]phenyl]phenyl]-4-methyl-3-pyridinyl]butan-1-ol |
|---|---|
| PubChem CID | 160806245 |
| Molecular Formula | C31H32Cl3N3O3 |
| Molecular Weight | 600.97 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 4-[2-chloro-6-[2-chloro-3-[2-chloro-3-[5-[(2-hydroxyethylamino)methyl]-6-methoxy-2-pyridinyl]phenyl]phenyl]-4-methyl-3-pyridinyl]butan-1-ol |
| SMILES | COc1nc(-c2cccc(-c3cccc(-c4cc(C)c(CCCCO)c(Cl)n4)c3Cl)c2Cl)ccc1CNCCO |
| InChI | InChI=1S/C31H32Cl3N3O3/c1-19-17-27(36-30(34)21(19)7-3-4-15-38)25-11-6-9-23(29(25)33)22-8-5-10-24(28(22)32)26-13-12-20(18-35-14-16-39)31(37-26)40-2/h5-6,8-13,17,35,38-39H,3-4,7,14-16,18H2,1-2H3 |
| InChIKey | SDSMEOUNWOOZGR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.97 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|