About acetonitrile;N,N-dimethylpyridin-4-amine
acetonitrile;N,N-dimethylpyridin-4-amine (PubChem CID 160806419) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is acetonitrile;N,N-dimethylpyridin-4-amine.
Molecular Properties
| Compound Name | acetonitrile;N,N-dimethylpyridin-4-amine |
| PubChem CID | 160806419 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | acetonitrile;N,N-dimethylpyridin-4-amine |
| SMILES | CC#N.CN(C)c1ccncc1 |
| InChI | InChI=1S/C7H10N2.C2H3N/c1-9(2)7-3-5-8-6-4-7;1-2-3/h3-6H,1-2H3;1H3 |
| InChIKey | SDTAGXVLKGSKPC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;N,N-dimethylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;N,N-dimethylpyridin-4-amine?
The IUPAC name of acetonitrile;N,N-dimethylpyridin-4-amine (CID 160806419) is acetonitrile;N,N-dimethylpyridin-4-amine.
What is the SMILES notation for acetonitrile;N,N-dimethylpyridin-4-amine?
The canonical SMILES for acetonitrile;N,N-dimethylpyridin-4-amine is CC#N.CN(C)c1ccncc1.
What is the InChIKey of acetonitrile;N,N-dimethylpyridin-4-amine?
The InChIKey is SDTAGXVLKGSKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H3N/c1-9(2)7-3-5-8-6-4-7;1-2-3/h3-6H,1-2H3;1H3.
What are the key properties of acetonitrile;N,N-dimethylpyridin-4-amine?
acetonitrile;N,N-dimethylpyridin-4-amine has a molecular weight of 163.22 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;N,N-dimethylpyridin-4-amine is sourced from PubChem (CID 160806419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).