About ethenylsilane;furan-2,5-dione
ethenylsilane;furan-2,5-dione (PubChem CID 160806423) has the molecular formula C6H8O3Si
and a molecular weight of 156.21 g/mol. Its IUPAC name is ethenylsilane;furan-2,5-dione.
Molecular Properties
| Compound Name | ethenylsilane;furan-2,5-dione |
| PubChem CID | 160806423 |
| Molecular Formula | C6H8O3Si |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | ethenylsilane;furan-2,5-dione |
| SMILES | C=C[SiH3].O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3.C2H6Si/c5-3-1-2-4(6)7-3;1-2-3/h1-2H;2H,1H2,3H3 |
| InChIKey | SDTALRJWYIESHH-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenylsilane;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylsilane;furan-2,5-dione?
The IUPAC name of ethenylsilane;furan-2,5-dione (CID 160806423) is ethenylsilane;furan-2,5-dione.
What is the SMILES notation for ethenylsilane;furan-2,5-dione?
The canonical SMILES for ethenylsilane;furan-2,5-dione is C=C[SiH3].O=C1C=CC(=O)O1.
What is the InChIKey of ethenylsilane;furan-2,5-dione?
The InChIKey is SDTALRJWYIESHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.C2H6Si/c5-3-1-2-4(6)7-3;1-2-3/h1-2H;2H,1H2,3H3.
What are the key properties of ethenylsilane;furan-2,5-dione?
ethenylsilane;furan-2,5-dione has a molecular weight of 156.21 g/mol, XLogP of -0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylsilane;furan-2,5-dione is sourced from PubChem (CID 160806423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).