C41H48BBrN2O10 — CID 160806971
tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromopyridine-2-carboxylate;4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]pyridine-2-carboxylic acid (PubChem CID 160806971) has the molecular formula C41H48BBrN2O10 and a molecular weight of 819.55 g/mol. Its IUPAC name is tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromopyridine-2-carboxylate;4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]pyridine-2-carboxylic acid.
| Compound Name | tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromopyridine-2-carboxylate;4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 160806971 |
| Molecular Formula | C41H48BBrN2O10 |
| Molecular Weight | 819.55 g/mol |
| Exact Mass | 818.26 |
| IUPAC Name | tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromopyridine-2-carboxylate;4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]pyridine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)c1ccccc1-c1ccnc(C(=O)O)c1.CC(C)(C)OC(=O)c1ccccc1B1OC(C)(C)C(C)(C)O1.COC(=O)c1cc(Br)ccn1 |
| InChI | InChI=1S/C17H25BO4.C17H17NO4.C7H6BrNO2/c1-15(2,3)20-14(19)12-10-8-9-11-13(12)18-21-16(4,5)17(6,7)22-18;1-17(2,3)22-16(21)13-7-5-4-6-12(13)11-8-9-18-14(10-11)15(19)20;1-11-7(10)6-4-5(8)2-3-9-6/h8-11H,1-7H3;4-10H,1-3H3,(H,19,20);2-4H,1H3 |
| InChIKey | SDUYFHFYMZFSKY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.55 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|