C23H30O4 — CID 160807405
methyl 2-methyl-2-(4-methylphenyl)propanoate;2-methyl-2-(4-methylphenyl)propanoic acid (PubChem CID 160807405) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl 2-methyl-2-(4-methylphenyl)propanoate;2-methyl-2-(4-methylphenyl)propanoic acid.
| Compound Name | methyl 2-methyl-2-(4-methylphenyl)propanoate;2-methyl-2-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 160807405 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | methyl 2-methyl-2-(4-methylphenyl)propanoate;2-methyl-2-(4-methylphenyl)propanoic acid |
| SMILES | COC(=O)C(C)(C)c1ccc(C)cc1.Cc1ccc(C(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C12H16O2.C11H14O2/c1-9-5-7-10(8-6-9)12(2,3)11(13)14-4;1-8-4-6-9(7-5-8)11(2,3)10(12)13/h5-8H,1-4H3;4-7H,1-3H3,(H,12,13) |
| InChIKey | SDWIOFFSHAGHHN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |