About propane;propan-2-one;prop-1-ene
propane;propan-2-one;prop-1-ene (PubChem CID 160807834) has the molecular formula C9H20O
and a molecular weight of 144.26 g/mol. Its IUPAC name is propane;propan-2-one;prop-1-ene.
Molecular Properties
| Compound Name | propane;propan-2-one;prop-1-ene |
| PubChem CID | 160807834 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | propane;propan-2-one;prop-1-ene |
| SMILES | C=CC.CC(C)=O.CCC |
| InChI | InChI=1S/C3H6O.C3H8.C3H6/c1-3(2)4;2*1-3-2/h1-2H3;3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | SDXULWBTTDDJQC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propane;propan-2-one;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;propan-2-one;prop-1-ene?
The IUPAC name of propane;propan-2-one;prop-1-ene (CID 160807834) is propane;propan-2-one;prop-1-ene.
What is the SMILES notation for propane;propan-2-one;prop-1-ene?
The canonical SMILES for propane;propan-2-one;prop-1-ene is C=CC.CC(C)=O.CCC.
What is the InChIKey of propane;propan-2-one;prop-1-ene?
The InChIKey is SDXULWBTTDDJQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C3H8.C3H6/c1-3(2)4;2*1-3-2/h1-2H3;3H2,1-2H3;3H,1H2,2H3.
What are the key properties of propane;propan-2-one;prop-1-ene?
propane;propan-2-one;prop-1-ene has a molecular weight of 144.26 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;propan-2-one;prop-1-ene is sourced from PubChem (CID 160807834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).