C18H15ClN4O — CID 160807964
4-[[4-[(2-chlorophenyl)methyl]pyrimidin-2-yl]amino]benzamide (PubChem CID 160807964) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is 4-[[4-[(2-chlorophenyl)methyl]pyrimidin-2-yl]amino]benzamide.
| Compound Name | 4-[[4-[(2-chlorophenyl)methyl]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 160807964 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[[4-[(2-chlorophenyl)methyl]pyrimidin-2-yl]amino]benzamide |
| SMILES | NC(=O)c1ccc(Nc2nccc(Cc3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C18H15ClN4O/c19-16-4-2-1-3-13(16)11-15-9-10-21-18(23-15)22-14-7-5-12(6-8-14)17(20)24/h1-10H,11H2,(H2,20,24)(H,21,22,23) |
| InChIKey | VRNQUMPDFGNMRS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |