C13H17N5 — CID 16081
2-N,4-N-diethyl-6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 16081) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-N,4-N-diethyl-6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-diethyl-6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 16081 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-N,4-N-diethyl-6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NCC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H17N5/c1-3-14-12-16-11(10-8-6-5-7-9-10)17-13(18-12)15-4-2/h5-9H,3-4H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | JORVMOGILHGALE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |