C29H47F2N5O4S — CID 160811468
6-(cyclopropylmethoxy)-5-(3,3-difluoroazetidin-1-yl)pyridine-2-carboxylic acid;[4-(nonylamino)thian-4-yl]methylurea (PubChem CID 160811468) has the molecular formula C29H47F2N5O4S and a molecular weight of 599.79 g/mol. Its IUPAC name is 6-(cyclopropylmethoxy)-5-(3,3-difluoroazetidin-1-yl)pyridine-2-carboxylic acid;[4-(nonylamino)thian-4-yl]methylurea.
| Compound Name | 6-(cyclopropylmethoxy)-5-(3,3-difluoroazetidin-1-yl)pyridine-2-carboxylic acid;[4-(nonylamino)thian-4-yl]methylurea |
|---|---|
| PubChem CID | 160811468 |
| Molecular Formula | C29H47F2N5O4S |
| Molecular Weight | 599.79 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | 6-(cyclopropylmethoxy)-5-(3,3-difluoroazetidin-1-yl)pyridine-2-carboxylic acid;[4-(nonylamino)thian-4-yl]methylurea |
| SMILES | CCCCCCCCCNC1(CNC(N)=O)CCSCC1.O=C(O)c1ccc(N2CC(F)(F)C2)c(OCC2CC2)n1 |
| InChI | InChI=1S/C16H33N3OS.C13H14F2N2O3/c1-2-3-4-5-6-7-8-11-19-16(14-18-15(17)20)9-12-21-13-10-16;14-13(15)6-17(7-13)10-4-3-9(12(18)19)16-11(10)20-5-8-1-2-8/h19H,2-14H2,1H3,(H3,17,18,20);3-4,8H,1-2,5-7H2,(H,18,19) |
| InChIKey | SEIUEDXPHWWBKG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.79 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|