About (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one
(3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one (PubChem CID 160811561) has the molecular formula C20H17F2N3O3
and a molecular weight of 385.37 g/mol. Its IUPAC name is (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one |
| PubChem CID | 160811561 |
| Molecular Formula | C20H17F2N3O3 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one |
| SMILES | O=C(CCc1cc(F)cc(F)c1)[C@]1(O)CCN(c2ccc3[nH]ncc3c2)C1=O |
| InChI | InChI=1S/C20H17F2N3O3/c21-14-7-12(8-15(22)10-14)1-4-18(26)20(28)5-6-25(19(20)27)16-2-3-17-13(9-16)11-23-24-17/h2-3,7-11,28H,1,4-6H2,(H,23,24)/t20-/m1/s1 |
| InChIKey | KZSNDXKBRAVBMV-HXUWFJFHSA-N |
| XLogP | 2.51 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one?
The IUPAC name of (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one (CID 160811561) is (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one.
What is the SMILES notation for (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one?
The canonical SMILES for (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one is O=C(CCc1cc(F)cc(F)c1)[C@]1(O)CCN(c2ccc3[nH]ncc3c2)C1=O.
What is the InChIKey of (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one?
The InChIKey is KZSNDXKBRAVBMV-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H17F2N3O3/c21-14-7-12(8-15(22)10-14)1-4-18(26)20(28)5-6-25(19(20)27)16-2-3-17-13(9-16)11-23-24-17/h2-3,7-11,28H,1,4-6H2,(H,23,24)/t20-/m1/s1.
What are the key properties of (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one?
(3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one has a molecular weight of 385.37 g/mol, XLogP of 2.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[3-(3,5-difluorophenyl)propanoyl]-3-hydroxy-1-(1H-indazol-5-yl)pyrrolidin-2-one is sourced from PubChem (CID 160811561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).