C12H14O8 — CID 160811624
(E)-but-2-enedioic acid;(8Z)-2,3,4,5-tetrahydro-1,6-dioxecine-7,10-dione (PubChem CID 160811624) has the molecular formula C12H14O8 and a molecular weight of 286.24 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(8Z)-2,3,4,5-tetrahydro-1,6-dioxecine-7,10-dione.
| Compound Name | (E)-but-2-enedioic acid;(8Z)-2,3,4,5-tetrahydro-1,6-dioxecine-7,10-dione |
|---|---|
| PubChem CID | 160811624 |
| Molecular Formula | C12H14O8 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (E)-but-2-enedioic acid;(8Z)-2,3,4,5-tetrahydro-1,6-dioxecine-7,10-dione |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1/C=C\C(=O)OCCCCO1 |
| InChI | InChI=1S/C8H10O4.C4H4O4/c9-7-3-4-8(10)12-6-2-1-5-11-7;5-3(6)1-2-4(7)8/h3-4H,1-2,5-6H2;1-2H,(H,5,6)(H,7,8)/b4-3-;2-1+ |
| InChIKey | SEJGTYWNDBTOJK-WSIDDKTASA-N |
| XLogP | 0.13 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|