C6H20O4Si4 — CID 160811652
hex-1-ene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 160811652) has the molecular formula C6H20O4Si4 and a molecular weight of 268.57 g/mol. Its IUPAC name is hex-1-ene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | hex-1-ene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 160811652 |
| Molecular Formula | C6H20O4Si4 |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | hex-1-ene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=CCCCC.O1[SiH2]O[SiH2]O[SiH2]O[SiH2]1 |
| InChI | InChI=1S/C6H12.H8O4Si4/c1-3-5-6-4-2;1-5-2-7-4-8-3-6-1/h3H,1,4-6H2,2H3;5-8H2 |
| InChIKey | SEJJDCNTYPNOCS-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|