About anthracene;1H-pyrimidine-2,4-dione
anthracene;1H-pyrimidine-2,4-dione (PubChem CID 160812079) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is anthracene;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | anthracene;1H-pyrimidine-2,4-dione |
| PubChem CID | 160812079 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | anthracene;1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc[nH]c(=O)[nH]1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C4H4N2O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-3-1-2-5-4(8)6-3/h1-10H;1-2H,(H2,5,6,7,8) |
| InChIKey | SEKROWDVZDTOLA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;1H-pyrimidine-2,4-dione?
The IUPAC name of anthracene;1H-pyrimidine-2,4-dione (CID 160812079) is anthracene;1H-pyrimidine-2,4-dione.
What is the SMILES notation for anthracene;1H-pyrimidine-2,4-dione?
The canonical SMILES for anthracene;1H-pyrimidine-2,4-dione is O=c1cc[nH]c(=O)[nH]1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;1H-pyrimidine-2,4-dione?
The InChIKey is SEKROWDVZDTOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C4H4N2O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-3-1-2-5-4(8)6-3/h1-10H;1-2H,(H2,5,6,7,8).
What are the key properties of anthracene;1H-pyrimidine-2,4-dione?
anthracene;1H-pyrimidine-2,4-dione has a molecular weight of 290.32 g/mol, XLogP of 3.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 160812079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).