About formonitrile;1-methyl-3-methylidenecyclobutane
formonitrile;1-methyl-3-methylidenecyclobutane (PubChem CID 160812987) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is formonitrile;1-methyl-3-methylidenecyclobutane.
Molecular Properties
| Compound Name | formonitrile;1-methyl-3-methylidenecyclobutane |
| PubChem CID | 160812987 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | formonitrile;1-methyl-3-methylidenecyclobutane |
| SMILES | C#N.C=C1CC(C)C1 |
| InChI | InChI=1S/C6H10.CHN/c1-5-3-6(2)4-5;1-2/h6H,1,3-4H2,2H3;1H |
| InChIKey | SENSBDFFJMMBRW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formonitrile;1-methyl-3-methylidenecyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;1-methyl-3-methylidenecyclobutane?
The IUPAC name of formonitrile;1-methyl-3-methylidenecyclobutane (CID 160812987) is formonitrile;1-methyl-3-methylidenecyclobutane.
What is the SMILES notation for formonitrile;1-methyl-3-methylidenecyclobutane?
The canonical SMILES for formonitrile;1-methyl-3-methylidenecyclobutane is C#N.C=C1CC(C)C1.
What is the InChIKey of formonitrile;1-methyl-3-methylidenecyclobutane?
The InChIKey is SENSBDFFJMMBRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10.CHN/c1-5-3-6(2)4-5;1-2/h6H,1,3-4H2,2H3;1H.
What are the key properties of formonitrile;1-methyl-3-methylidenecyclobutane?
formonitrile;1-methyl-3-methylidenecyclobutane has a molecular weight of 109.17 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;1-methyl-3-methylidenecyclobutane is sourced from PubChem (CID 160812987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).