About [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane
[acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane (PubChem CID 160814180) has the molecular formula C17H19I2NO4
and a molecular weight of 555.15 g/mol. Its IUPAC name is [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane.
Molecular Properties
| Compound Name | [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane |
| PubChem CID | 160814180 |
| Molecular Formula | C17H19I2NO4 |
| Molecular Weight | 555.15 g/mol |
| Exact Mass | 554.94 |
| IUPAC Name | [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane |
| SMILES | C/N=I/c1ccccc1.CC(=O)OI(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C10H11IO4.C7H8IN/c1-8(12)14-11(15-9(2)13)10-6-4-3-5-7-10;1-9-8-7-5-3-2-4-6-7/h3-7H,1-2H3;2-6H,1H3 |
| InChIKey | SERQIDVAMFGRAH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.15 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane?
The IUPAC name of [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane (CID 160814180) is [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane.
What is the SMILES notation for [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane?
The canonical SMILES for [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane is C/N=I/c1ccccc1.CC(=O)OI(OC(C)=O)c1ccccc1.
What is the InChIKey of [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane?
The InChIKey is SERQIDVAMFGRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO4.C7H8IN/c1-8(12)14-11(15-9(2)13)10-6-4-3-5-7-10;1-9-8-7-5-3-2-4-6-7/h3-7H,1-2H3;2-6H,1H3.
What are the key properties of [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane?
[acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane has a molecular weight of 555.15 g/mol, XLogP of 4.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy(phenyl)-λ3-iodanyl] acetate;methylimino(phenyl)-λ3-iodane is sourced from PubChem (CID 160814180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).