About CID 160815925
CID 160815925 (PubChem CID 160815925) has the molecular formula C7H13BO4
and a molecular weight of 171.99 g/mol.
Molecular Properties
| Compound Name | CID 160815925 |
| PubChem CID | 160815925 |
| Molecular Formula | C7H13BO4 |
| Molecular Weight | 171.99 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)[C@@H](O)C1(C)O |
| InChI | InChI=1S/C7H13BO4/c1-7(10)5(9)4(3-11-2)12-6(7)8/h4-6,9-10H,3H2,1-2H3/t4-,5-,6-,7?/m1/s1 |
| InChIKey | CBIKGDHCOIPBLO-RKEPMNIXSA-N |
| XLogP | -1.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.99 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 160815925 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160815925?
The IUPAC name of CID 160815925 (CID 160815925) is not available.
What is the SMILES notation for CID 160815925?
The canonical SMILES for CID 160815925 is [B][C@@H]1O[C@H](COC)[C@@H](O)C1(C)O.
What is the InChIKey of CID 160815925?
The InChIKey is CBIKGDHCOIPBLO-RKEPMNIXSA-N. The full InChI is InChI=1S/C7H13BO4/c1-7(10)5(9)4(3-11-2)12-6(7)8/h4-6,9-10H,3H2,1-2H3/t4-,5-,6-,7?/m1/s1.
What are the key properties of CID 160815925?
CID 160815925 has a molecular weight of 171.99 g/mol, XLogP of -1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160815925 is sourced from PubChem (CID 160815925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).