C21H28FN3O3S3 — CID 160816673
1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea;sulfane (PubChem CID 160816673) has the molecular formula C21H28FN3O3S3 and a molecular weight of 485.67 g/mol. Its IUPAC name is 1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea;sulfane.
| Compound Name | 1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea;sulfane |
|---|---|
| PubChem CID | 160816673 |
| Molecular Formula | C21H28FN3O3S3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[4-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea;sulfane |
| SMILES | CNS(=O)(=NC(=O)Nc1c2c(c(F)c3c1CCC3)CCC2)c1cc(C(C)(C)O)cs1.S |
| InChI | InChI=1S/C21H26FN3O3S2.H2S/c1-21(2,27)12-10-17(29-11-12)30(28,23-3)25-20(26)24-19-15-8-4-6-13(15)18(22)14-7-5-9-16(14)19;/h10-11,27H,4-9H2,1-3H3,(H2,23,24,25,26,28);1H2 |
| InChIKey | SEZKZEIQHMDPIP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |