About 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine
2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine (PubChem CID 160817773) has the molecular formula C13H18Cl2N2O3
and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine |
| PubChem CID | 160817773 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine |
| SMILES | CCCCNCC(=O)O.ON=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H5Cl2NO.C6H13NO2/c8-6-2-1-5(4-10-11)3-7(6)9;1-2-3-4-7-5-6(8)9/h1-4,11H;7H,2-5H2,1H3,(H,8,9) |
| InChIKey | SFCYZWQXMKDKRZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine?
The IUPAC name of 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine (CID 160817773) is 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine.
What is the SMILES notation for 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine?
The canonical SMILES for 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine is CCCCNCC(=O)O.ON=Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine?
The InChIKey is SFCYZWQXMKDKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2NO.C6H13NO2/c8-6-2-1-5(4-10-11)3-7(6)9;1-2-3-4-7-5-6(8)9/h1-4,11H;7H,2-5H2,1H3,(H,8,9).
What are the key properties of 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine?
2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine has a molecular weight of 321.20 g/mol, XLogP of 3.26, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)acetic acid;N-[(3,4-dichlorophenyl)methylidene]hydroxylamine is sourced from PubChem (CID 160817773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).