C19H23N5O2 — CID 160820098
(5aS,6S,9aR)-8-isocyano-2,6,9a-trimethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one;tritiomethane (PubChem CID 160820098) has the molecular formula C19H23N5O2 and a molecular weight of 355.43 g/mol. Its IUPAC name is (5aS,6S,9aR)-8-isocyano-2,6,9a-trimethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one;tritiomethane.
| Compound Name | (5aS,6S,9aR)-8-isocyano-2,6,9a-trimethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one;tritiomethane |
|---|---|
| PubChem CID | 160820098 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (5aS,6S,9aR)-8-isocyano-2,6,9a-trimethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one;tritiomethane |
| SMILES | [3H]C.[C-]#[N+]C1=C[C@]2(C)c3nn(C)c(-c4nnc(C)o4)c3CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C18H19N5O2.CH4/c1-9-12-7-6-11-14(17-21-20-10(2)25-17)23(5)22-16(11)18(12,3)8-13(19-4)15(9)24;/h8-9,12H,6-7H2,1-3,5H3;1H4/t9-,12-,18-;/m0./s1/i;1T |
| InChIKey | SFKUMXQUCQILHW-ITNRCXIXSA-N |
| XLogP | 3.26 |
| TPSA | 78.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|