C51H54O6S3 — CID 160820570
triphenylsulfanium;4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate (PubChem CID 160820570) has the molecular formula C51H54O6S3 and a molecular weight of 859.19 g/mol. Its IUPAC name is triphenylsulfanium;4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate.
| Compound Name | triphenylsulfanium;4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 160820570 |
| Molecular Formula | C51H54O6S3 |
| Molecular Weight | 859.19 g/mol |
| Exact Mass | 858.31 |
| IUPAC Name | triphenylsulfanium;4-[2,4,6-tris(1-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(OS(=O)(=O)c2c(C34CCC(CC3)C4)cc(C34CCC(CC3)C4)cc2C23CCC(CC2)C3)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H40O6S2.C18H15S/c34-40(35,36)27-3-1-26(2-4-27)39-41(37,38)30-28(32-13-7-23(20-32)8-14-32)17-25(31-11-5-22(19-31)6-12-31)18-29(30)33-15-9-24(21-33)10-16-33;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-4,17-18,22-24H,5-16,19-21H2,(H,34,35,36);1-15H/q;+1/p-1 |
| InChIKey | SFMJRYHZJIAGHN-UHFFFAOYSA-M |
| XLogP | 11.64 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.19 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|