C35H31F2NO4 — CID 160821164
N-benzyl-1-(difluoromethoxy)-2-[1-(3,4-dimethoxyphenyl)-6H-benzo[c]chromen-8-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 160821164) has the molecular formula C35H31F2NO4 and a molecular weight of 567.63 g/mol. Its IUPAC name is N-benzyl-1-(difluoromethoxy)-2-[1-(3,4-dimethoxyphenyl)-6H-benzo[c]chromen-8-yl]cyclohexa-2,4-dien-1-amine.
| Compound Name | N-benzyl-1-(difluoromethoxy)-2-[1-(3,4-dimethoxyphenyl)-6H-benzo[c]chromen-8-yl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 160821164 |
| Molecular Formula | C35H31F2NO4 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | N-benzyl-1-(difluoromethoxy)-2-[1-(3,4-dimethoxyphenyl)-6H-benzo[c]chromen-8-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | COc1ccc(-c2cccc3c2-c2ccc(C4=CC=CCC4(NCc4ccccc4)OC(F)F)cc2CO3)cc1OC |
| InChI | InChI=1S/C35H31F2NO4/c1-39-30-17-15-24(20-32(30)40-2)27-11-8-13-31-33(27)28-16-14-25(19-26(28)22-41-31)29-12-6-7-18-35(29,42-34(36)37)38-21-23-9-4-3-5-10-23/h3-17,19-20,34,38H,18,21-22H2,1-2H3 |
| InChIKey | SFOKGJXNMZBULM-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|