About tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole
tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole (PubChem CID 160822244) has the molecular formula C35H34N2O4
and a molecular weight of 546.67 g/mol. Its IUPAC name is tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole.
Molecular Properties
| Compound Name | tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole |
| PubChem CID | 160822244 |
| Molecular Formula | C35H34N2O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole |
| SMILES | CC(C)(C)OC(=O)n1ccc2ccc(OCc3ccccc3)cc21.c1ccc(COc2ccc3cc[nH]c3c2)cc1 |
| InChI | InChI=1S/C20H21NO3.C15H13NO/c1-20(2,3)24-19(22)21-12-11-16-9-10-17(13-18(16)21)23-14-15-7-5-4-6-8-15;1-2-4-12(5-3-1)11-17-14-7-6-13-8-9-16-15(13)10-14/h4-13H,14H2,1-3H3;1-10,16H,11H2 |
| InChIKey | SFRUOXJKNBXONK-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole?
The IUPAC name of tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole (CID 160822244) is tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole.
What is the SMILES notation for tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole?
The canonical SMILES for tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole is CC(C)(C)OC(=O)n1ccc2ccc(OCc3ccccc3)cc21.c1ccc(COc2ccc3cc[nH]c3c2)cc1.
What is the InChIKey of tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole?
The InChIKey is SFRUOXJKNBXONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3.C15H13NO/c1-20(2,3)24-19(22)21-12-11-16-9-10-17(13-18(16)21)23-14-15-7-5-4-6-8-15;1-2-4-12(5-3-1)11-17-14-7-6-13-8-9-16-15(13)10-14/h4-13H,14H2,1-3H3;1-10,16H,11H2.
What are the key properties of tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole?
tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole has a molecular weight of 546.67 g/mol, XLogP of 8.75, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-phenylmethoxyindole-1-carboxylate;6-phenylmethoxy-1H-indole is sourced from PubChem (CID 160822244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).