C21H23FIN5O2 — CID 160823239
5-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 160823239) has the molecular formula C21H23FIN5O2 and a molecular weight of 523.35 g/mol. Its IUPAC name is 5-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 160823239 |
| Molecular Formula | C21H23FIN5O2 |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 5-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Fc1cc(I)ccc1Cc1cnccc1-c1nnc(NCCCN2CCOCC2)o1 |
| InChI | InChI=1S/C21H23FIN5O2/c22-19-13-17(23)3-2-15(19)12-16-14-24-6-4-18(16)20-26-27-21(30-20)25-5-1-7-28-8-10-29-11-9-28/h2-4,6,13-14H,1,5,7-12H2,(H,25,27) |
| InChIKey | SFUZEKYLMQLXMP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|