About (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane
(1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane (PubChem CID 160824434) has the molecular formula C6H17NOS2
and a molecular weight of 183.34 g/mol. Its IUPAC name is (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane.
Molecular Properties
| Compound Name | (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane |
| PubChem CID | 160824434 |
| Molecular Formula | C6H17NOS2 |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane |
| SMILES | C[C@H](O)[C@H]1CCNC1.S.S |
| InChI | InChI=1S/C6H13NO.2H2S/c1-5(8)6-2-3-7-4-6;;/h5-8H,2-4H2,1H3;2*1H2/t5-,6-;;/m0../s1 |
| InChIKey | SFYYSROPNXBFNL-USPAICOZSA-N |
| XLogP | 0.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane?
The IUPAC name of (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane (CID 160824434) is (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane.
What is the SMILES notation for (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane?
The canonical SMILES for (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane is C[C@H](O)[C@H]1CCNC1.S.S.
What is the InChIKey of (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane?
The InChIKey is SFYYSROPNXBFNL-USPAICOZSA-N. The full InChI is InChI=1S/C6H13NO.2H2S/c1-5(8)6-2-3-7-4-6;;/h5-8H,2-4H2,1H3;2*1H2/t5-,6-;;/m0../s1.
What are the key properties of (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane?
(1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane has a molecular weight of 183.34 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(3S)-pyrrolidin-3-yl]ethanol;sulfane is sourced from PubChem (CID 160824434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).