C26H30BBrN4O6 — CID 160827273
ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate;ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 160827273) has the molecular formula C26H30BBrN4O6 and a molecular weight of 585.26 g/mol. Its IUPAC name is ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate;ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate;ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 160827273 |
| Molecular Formula | C26H30BBrN4O6 |
| Molecular Weight | 585.26 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate;ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(B3OC(C)(C)C(C)(C)O3)cn12.CCOC(=O)c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C16H21BN2O4.C10H9BrN2O2/c1-6-21-14(20)12-9-18-13-8-7-11(10-19(12)13)17-22-15(2,3)16(4,5)23-17;1-2-15-10(14)8-5-12-9-4-3-7(11)6-13(8)9/h7-10H,6H2,1-5H3;3-6H,2H2,1H3 |
| InChIKey | SGIQOBXUXRMOQX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|