C16H23N3O5 — CID 160828469
N-[(3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-6-(2-phenylethoxyamino)-2,3,4,5-tetrahydropyridin-5-yl]acetamide (PubChem CID 160828469) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[(3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-6-(2-phenylethoxyamino)-2,3,4,5-tetrahydropyridin-5-yl]acetamide.
| Compound Name | N-[(3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-6-(2-phenylethoxyamino)-2,3,4,5-tetrahydropyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 160828469 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[(3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-6-(2-phenylethoxyamino)-2,3,4,5-tetrahydropyridin-5-yl]acetamide |
| SMILES | CC(=O)NC1C(NOCCc2ccccc2)=NC(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23N3O5/c1-10(21)17-13-15(23)14(22)12(9-20)18-16(13)19-24-8-7-11-5-3-2-4-6-11/h2-6,12-15,20,22-23H,7-9H2,1H3,(H,17,21)(H,18,19)/t12?,13?,14-,15-/m1/s1 |
| InChIKey | OMZYKNWPQCMOLI-NEXFUWMNSA-N |
| XLogP | -1.25 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|