C25H27N3O2 — CID 160829700
carbazol-9-yl-[4-[3-(hydroxymethyl)phenyl]piperazin-1-yl]methanone;methane (PubChem CID 160829700) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is carbazol-9-yl-[4-[3-(hydroxymethyl)phenyl]piperazin-1-yl]methanone;methane.
| Compound Name | carbazol-9-yl-[4-[3-(hydroxymethyl)phenyl]piperazin-1-yl]methanone;methane |
|---|---|
| PubChem CID | 160829700 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | carbazol-9-yl-[4-[3-(hydroxymethyl)phenyl]piperazin-1-yl]methanone;methane |
| SMILES | C.O=C(N1CCN(c2cccc(CO)c2)CC1)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C24H23N3O2.CH4/c28-17-18-6-5-7-19(16-18)25-12-14-26(15-13-25)24(29)27-22-10-3-1-8-20(22)21-9-2-4-11-23(21)27;/h1-11,16,28H,12-15,17H2;1H4 |
| InChIKey | SGQCZCNDGBENSW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |