C41H35Cl2F3N8O2 — CID 160830761
2-[6-chloro-4-[4-[7-[4-[7-chloro-3-(diaminomethylideneamino)naphthalen-1-yl]-3-methylphenyl]-3,5-dioxoheptyl]-2-(trifluoromethyl)phenyl]quinazolin-2-yl]guanidine (PubChem CID 160830761) has the molecular formula C41H35Cl2F3N8O2 and a molecular weight of 799.69 g/mol. Its IUPAC name is 2-[6-chloro-4-[4-[7-[4-[7-chloro-3-(diaminomethylideneamino)naphthalen-1-yl]-3-methylphenyl]-3,5-dioxoheptyl]-2-(trifluoromethyl)phenyl]quinazolin-2-yl]guanidine.
| Compound Name | 2-[6-chloro-4-[4-[7-[4-[7-chloro-3-(diaminomethylideneamino)naphthalen-1-yl]-3-methylphenyl]-3,5-dioxoheptyl]-2-(trifluoromethyl)phenyl]quinazolin-2-yl]guanidine |
|---|---|
| PubChem CID | 160830761 |
| Molecular Formula | C41H35Cl2F3N8O2 |
| Molecular Weight | 799.69 g/mol |
| Exact Mass | 798.22 |
| IUPAC Name | 2-[6-chloro-4-[4-[7-[4-[7-chloro-3-(diaminomethylideneamino)naphthalen-1-yl]-3-methylphenyl]-3,5-dioxoheptyl]-2-(trifluoromethyl)phenyl]quinazolin-2-yl]guanidine |
| SMILES | Cc1cc(CCC(=O)CC(=O)CCc2ccc(-c3nc(N=C(N)N)nc4ccc(Cl)cc34)c(C(F)(F)F)c2)ccc1-c1cc(N=C(N)N)cc2ccc(Cl)cc12 |
| InChI | InChI=1S/C41H35Cl2F3N8O2/c1-21-14-22(4-11-30(21)33-19-27(51-38(47)48)16-24-6-7-25(42)17-32(24)33)2-9-28(55)20-29(56)10-3-23-5-12-31(35(15-23)41(44,45)46)37-34-18-26(43)8-13-36(34)52-40(53-37)54-39(49)50/h4-8,11-19H,2-3,9-10,20H2,1H3,(H4,47,48,51)(H4,49,50,52,53,54) |
| InChIKey | XXIREXAVFDGYFN-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 188.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.69 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|