C7H12N2 — CID 160834606
1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine (PubChem CID 160834606) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine.
| Compound Name | 1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 160834606 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
| SMILES | NC1C=C2CNCC2C1 |
| InChI | InChI=1S/C7H12N2/c8-7-1-5-3-9-4-6(5)2-7/h1,6-7,9H,2-4,8H2 |
| InChIKey | SHGDMLVQOSMUIM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|