C22H19ClN6O5 — CID 160835125
(4R,6S,7S)-17-chloro-4,6-dimethyl-13-pyrazin-2-ylspiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-2',4',6'-trione (PubChem CID 160835125) has the molecular formula C22H19ClN6O5 and a molecular weight of 482.88 g/mol. Its IUPAC name is (4R,6S,7S)-17-chloro-4,6-dimethyl-13-pyrazin-2-ylspiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-2',4',6'-trione.
| Compound Name | (4R,6S,7S)-17-chloro-4,6-dimethyl-13-pyrazin-2-ylspiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-2',4',6'-trione |
|---|---|
| PubChem CID | 160835125 |
| Molecular Formula | C22H19ClN6O5 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | (4R,6S,7S)-17-chloro-4,6-dimethyl-13-pyrazin-2-ylspiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-2',4',6'-trione |
| SMILES | C[C@@H]1CN2c3c(nc4c(-c5cnccn5)noc4c3Cl)CC3(C(=O)CC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C22H19ClN6O5/c1-9-8-29-18-11(6-22(20(29)10(2)33-9)13(30)5-14(31)27-21(22)32)26-17-16(12-7-24-3-4-25-12)28-34-19(17)15(18)23/h3-4,7,9-10,20H,5-6,8H2,1-2H3,(H,27,31,32)/t9-,10+,20-,22?/m1/s1 |
| InChIKey | SHHSRLROZDZLEU-MVMGUTEHSA-N |
| XLogP | 1.47 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|