C8Br2N2O2 — CID 160836540
2,5-dibromo-4-isocyano-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile (PubChem CID 160836540) has the molecular formula C8Br2N2O2 and a molecular weight of 315.91 g/mol. Its IUPAC name is 2,5-dibromo-4-isocyano-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile.
| Compound Name | 2,5-dibromo-4-isocyano-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 160836540 |
| Molecular Formula | C8Br2N2O2 |
| Molecular Weight | 315.91 g/mol |
| Exact Mass | 313.83 |
| IUPAC Name | 2,5-dibromo-4-isocyano-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile |
| SMILES | [C-]#[N+]C1=C(Br)C(=O)C(C#N)=C(Br)C1=O |
| InChI | InChI=1S/C8Br2N2O2/c1-12-6-5(10)7(13)3(2-11)4(9)8(6)14 |
| InChIKey | AGJWRWQGGIOVAJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.91 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|